About 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride
7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride (PubChem CID 172897075) has the molecular formula C19H26ClNO4
and a molecular weight of 367.87 g/mol. Its IUPAC name is 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride.
Molecular Properties
| Compound Name | 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride |
| PubChem CID | 172897075 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride |
| SMILES | CCCc1cc(=O)oc2cc(C)cc(OCC3CNCCOC3)c12.Cl |
| InChI | InChI=1S/C19H25NO4.ClH/c1-3-4-15-9-18(21)24-17-8-13(2)7-16(19(15)17)23-12-14-10-20-5-6-22-11-14;/h7-9,14,20H,3-6,10-12H2,1-2H3;1H |
| InChIKey | QDPPFNSSGOKXMH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride?
The IUPAC name of 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride (CID 172897075) is 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride.
What is the SMILES notation for 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride?
The canonical SMILES for 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride is CCCc1cc(=O)oc2cc(C)cc(OCC3CNCCOC3)c12.Cl.
What is the InChIKey of 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride?
The InChIKey is QDPPFNSSGOKXMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO4.ClH/c1-3-4-15-9-18(21)24-17-8-13(2)7-16(19(15)17)23-12-14-10-20-5-6-22-11-14;/h7-9,14,20H,3-6,10-12H2,1-2H3;1H.
What are the key properties of 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride?
7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride has a molecular weight of 367.87 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5-(1,4-oxazepan-6-ylmethoxy)-4-propylchromen-2-one;hydrochloride is sourced from PubChem (CID 172897075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).