C22H37Cl2N5O — CID 172897202
(1R,9S)-5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride (PubChem CID 172897202) has the molecular formula C22H37Cl2N5O and a molecular weight of 458.48 g/mol. Its IUPAC name is (1R,9S)-5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride.
| Compound Name | (1R,9S)-5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride |
|---|---|
| PubChem CID | 172897202 |
| Molecular Formula | C22H37Cl2N5O |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (1R,9S)-5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;dihydrochloride |
| SMILES | CN1CCN(C)C2(CCN(Cc3ccc4n(c3=O)C[C@@H]3CNC[C@H]4C3)CC2)C1.Cl.Cl |
| InChI | InChI=1S/C22H35N5O.2ClH/c1-24-9-10-25(2)22(16-24)5-7-26(8-6-22)15-18-3-4-20-19-11-17(12-23-13-19)14-27(20)21(18)28;;/h3-4,17,19,23H,5-16H2,1-2H3;2*1H/t17-,19+;;/m0../s1 |
| InChIKey | PLEWERLCIBZKFT-UKWJXJBFSA-N |
| XLogP | 1.61 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |