C22H30N2O2 — CID 172897271
1'-[2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]ethyl]spiro[indene-1,4'-piperidine];formic acid (PubChem CID 172897271) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1'-[2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]ethyl]spiro[indene-1,4'-piperidine];formic acid.
| Compound Name | 1'-[2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]ethyl]spiro[indene-1,4'-piperidine];formic acid |
|---|---|
| PubChem CID | 172897271 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1'-[2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]ethyl]spiro[indene-1,4'-piperidine];formic acid |
| SMILES | C1=CC2(CCN(CCN3C[C@H]4CC[C@@H]3C4)CC2)c2ccccc21.O=CO |
| InChI | InChI=1S/C21H28N2.CH2O2/c1-2-4-20-18(3-1)7-8-21(20)9-11-22(12-10-21)13-14-23-16-17-5-6-19(23)15-17;2-1-3/h1-4,7-8,17,19H,5-6,9-16H2;1H,(H,2,3)/t17-,19+;/m0./s1 |
| InChIKey | YSHCJIJUMFIXAM-JUOYHRLASA-N |
| XLogP | 3.23 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|