C18H21FN2O3 — CID 172897275
2-[[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methyl]-8-fluoro-1H-quinolin-4-one (PubChem CID 172897275) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methyl]-8-fluoro-1H-quinolin-4-one.
| Compound Name | 2-[[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methyl]-8-fluoro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 172897275 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methyl]-8-fluoro-1H-quinolin-4-one |
| SMILES | O=c1cc(CN2CCO[C@H]3C[C@H](CO)C[C@@H]32)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C18H21FN2O3/c19-14-3-1-2-13-16(23)8-12(20-18(13)14)9-21-4-5-24-17-7-11(10-22)6-15(17)21/h1-3,8,11,15,17,22H,4-7,9-10H2,(H,20,23)/t11-,15+,17+/m1/s1 |
| InChIKey | FRKMVTMJPZMYAW-PJQXDXOGSA-N |
| XLogP | 1.64 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |