C13H20N4O2 — CID 172897472
[(4aS,6R,7aS)-4-(2-amino-6-methylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol (PubChem CID 172897472) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is [(4aS,6R,7aS)-4-(2-amino-6-methylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol.
| Compound Name | [(4aS,6R,7aS)-4-(2-amino-6-methylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
|---|---|
| PubChem CID | 172897472 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [(4aS,6R,7aS)-4-(2-amino-6-methylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
| SMILES | Cc1cc(N2CCO[C@H]3C[C@H](CO)C[C@@H]32)nc(N)n1 |
| InChI | InChI=1S/C13H20N4O2/c1-8-4-12(16-13(14)15-8)17-2-3-19-11-6-9(7-18)5-10(11)17/h4,9-11,18H,2-3,5-7H2,1H3,(H2,14,15,16)/t9-,10+,11+/m1/s1 |
| InChIKey | UOEDHJPLEGQCKC-VWYCJHECSA-N |
| XLogP | 0.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |