C31H32N4O5S — CID 172898424
2-[5-[(3,4-dimethylphenoxy)methyl]furan-2-yl]-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile (PubChem CID 172898424) has the molecular formula C31H32N4O5S and a molecular weight of 572.69 g/mol. Its IUPAC name is 2-[5-[(3,4-dimethylphenoxy)methyl]furan-2-yl]-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-[5-[(3,4-dimethylphenoxy)methyl]furan-2-yl]-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 172898424 |
| Molecular Formula | C31H32N4O5S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 2-[5-[(3,4-dimethylphenoxy)methyl]furan-2-yl]-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1ccc(OCc2ccc(-c3nc(C#N)c(N4CCN(S(=O)(=O)c5ccc6c(c5)CCCC6)CC4)o3)o2)cc1C |
| InChI | InChI=1S/C31H32N4O5S/c1-21-7-9-25(17-22(21)2)38-20-26-10-12-29(39-26)30-33-28(19-32)31(40-30)34-13-15-35(16-14-34)41(36,37)27-11-8-23-5-3-4-6-24(23)18-27/h7-12,17-18H,3-6,13-16,20H2,1-2H3 |
| InChIKey | HZZIZNZYUCTVOM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |