About 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile
5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile (PubChem CID 172898681) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile |
| PubChem CID | 172898681 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile |
| SMILES | CS(C)(=O)=Nc1cncc(C#N)c1 |
| InChI | InChI=1S/C8H9N3OS/c1-13(2,12)11-8-3-7(4-9)5-10-6-8/h3,5-6H,1-2H3 |
| InChIKey | WMZWUCZMBVMUJB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile?
The IUPAC name of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile (CID 172898681) is 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile.
What is the SMILES notation for 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile?
The canonical SMILES for 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile is CS(C)(=O)=Nc1cncc(C#N)c1.
What is the InChIKey of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile?
The InChIKey is WMZWUCZMBVMUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-13(2,12)11-8-3-7(4-9)5-10-6-8/h3,5-6H,1-2H3.
What are the key properties of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile?
5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile has a molecular weight of 195.25 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyridine-3-carbonitrile is sourced from PubChem (CID 172898681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).