About (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride
(3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride (PubChem CID 172899217) has the molecular formula C7H10ClF2N
and a molecular weight of 181.61 g/mol. Its IUPAC name is (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride |
| PubChem CID | 172899217 |
| Molecular Formula | C7H10ClF2N |
| Molecular Weight | 181.61 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride |
| SMILES | C#C[C@@H]1CNC[C@H]1C(F)F.Cl |
| InChI | InChI=1S/C7H9F2N.ClH/c1-2-5-3-10-4-6(5)7(8)9;/h1,5-7,10H,3-4H2;1H/t5-,6-;/m1./s1 |
| InChIKey | PFHRFRRJEGRQJK-KGZKBUQUSA-N |
| XLogP | 1.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.61 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride?
The IUPAC name of (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride (CID 172899217) is (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride.
What is the SMILES notation for (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride?
The canonical SMILES for (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride is C#C[C@@H]1CNC[C@H]1C(F)F.Cl.
What is the InChIKey of (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride?
The InChIKey is PFHRFRRJEGRQJK-KGZKBUQUSA-N. The full InChI is InChI=1S/C7H9F2N.ClH/c1-2-5-3-10-4-6(5)7(8)9;/h1,5-7,10H,3-4H2;1H/t5-,6-;/m1./s1.
What are the key properties of (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride?
(3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride has a molecular weight of 181.61 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-(difluoromethyl)-4-ethynylpyrrolidine;hydrochloride is sourced from PubChem (CID 172899217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).