C19H31N5O2 — CID 172899503
2-morpholin-4-yl-N-[1-(oxan-2-ylmethyl)piperidin-4-yl]pyrimidin-4-amine (PubChem CID 172899503) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-[1-(oxan-2-ylmethyl)piperidin-4-yl]pyrimidin-4-amine.
| Compound Name | 2-morpholin-4-yl-N-[1-(oxan-2-ylmethyl)piperidin-4-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172899503 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 2-morpholin-4-yl-N-[1-(oxan-2-ylmethyl)piperidin-4-yl]pyrimidin-4-amine |
| SMILES | c1cc(NC2CCN(CC3CCCCO3)CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H31N5O2/c1-2-12-26-17(3-1)15-23-8-5-16(6-9-23)21-18-4-7-20-19(22-18)24-10-13-25-14-11-24/h4,7,16-17H,1-3,5-6,8-15H2,(H,20,21,22) |
| InChIKey | WWMFGGJNALAMDJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |