C18H23N3O2 — CID 172899527
3-[3-(2,3-dihydroindole-1-carbonyl)pyrrolidin-1-yl]piperidin-2-one (PubChem CID 172899527) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[3-(2,3-dihydroindole-1-carbonyl)pyrrolidin-1-yl]piperidin-2-one.
| Compound Name | 3-[3-(2,3-dihydroindole-1-carbonyl)pyrrolidin-1-yl]piperidin-2-one |
|---|---|
| PubChem CID | 172899527 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-[3-(2,3-dihydroindole-1-carbonyl)pyrrolidin-1-yl]piperidin-2-one |
| SMILES | O=C1NCCCC1N1CCC(C(=O)N2CCc3ccccc32)C1 |
| InChI | InChI=1S/C18H23N3O2/c22-17-16(6-3-9-19-17)20-10-7-14(12-20)18(23)21-11-8-13-4-1-2-5-15(13)21/h1-2,4-5,14,16H,3,6-12H2,(H,19,22) |
| InChIKey | SVVUIVDJSFPCHE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |