About N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine
N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 172901042) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 172901042 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cn1ccc2c(NC3CCC3)ncnc21 |
| InChI | InChI=1S/C11H14N4/c1-15-6-5-9-10(12-7-13-11(9)15)14-8-3-2-4-8/h5-8H,2-4H2,1H3,(H,12,13,14) |
| InChIKey | CKQONBUOFZUELW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine (CID 172901042) is N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine is Cn1ccc2c(NC3CCC3)ncnc21.
What is the InChIKey of N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is CKQONBUOFZUELW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-15-6-5-9-10(12-7-13-11(9)15)14-8-3-2-4-8/h5-8H,2-4H2,1H3,(H,12,13,14).
What are the key properties of N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine?
N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 202.26 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-7-methylpyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 172901042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).