C18H23Cl2NO2 — CID 17290202
2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride (PubChem CID 17290202) has the molecular formula C18H23Cl2NO2 and a molecular weight of 356.29 g/mol. Its IUPAC name is 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17290202 |
| Molecular Formula | C18H23Cl2NO2 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride |
| SMILES | CCC(CO)NCc1cccc(OCc2ccc(Cl)cc2)c1.Cl |
| InChI | InChI=1S/C18H22ClNO2.ClH/c1-2-17(12-21)20-11-15-4-3-5-18(10-15)22-13-14-6-8-16(19)9-7-14;/h3-10,17,20-21H,2,11-13H2,1H3;1H |
| InChIKey | YYRJEETYKRNJAP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |