C20H26ClN5O — CID 172902048
N-[1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 172902048) has the molecular formula C20H26ClN5O and a molecular weight of 387.92 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172902048 |
| Molecular Formula | C20H26ClN5O |
| Molecular Weight | 387.92 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CN(c1ccnc(N2CCOCC2)n1)C1CCN(Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H26ClN5O/c1-24(19-5-7-22-20(23-19)26-9-11-27-12-10-26)18-6-8-25(15-18)14-16-3-2-4-17(21)13-16/h2-5,7,13,18H,6,8-12,14-15H2,1H3 |
| InChIKey | OYHITZFGXJNCJB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.92 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |