C19H23F3N6O — CID 172902096
2-morpholin-4-yl-N-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]pyrimidin-4-amine (PubChem CID 172902096) has the molecular formula C19H23F3N6O and a molecular weight of 408.43 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | 2-morpholin-4-yl-N-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172902096 |
| Molecular Formula | C19H23F3N6O |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-morpholin-4-yl-N-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cccc(N2CCCC(Nc3ccnc(N4CCOCC4)n3)C2)n1 |
| InChI | InChI=1S/C19H23F3N6O/c20-19(21,22)15-4-1-5-17(25-15)28-8-2-3-14(13-28)24-16-6-7-23-18(26-16)27-9-11-29-12-10-27/h1,4-7,14H,2-3,8-13H2,(H,23,24,26) |
| InChIKey | QKYZXLYUOAWPLA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |