C20H26N6 — CID 172903180
3-[[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]methyl]benzonitrile (PubChem CID 172903180) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 3-[[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 172903180 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3-[[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]methyl]benzonitrile |
| SMILES | CN(C)c1nccc(N(C)C2CCCN(Cc3cccc(C#N)c3)C2)n1 |
| InChI | InChI=1S/C20H26N6/c1-24(2)20-22-10-9-19(23-20)25(3)18-8-5-11-26(15-18)14-17-7-4-6-16(12-17)13-21/h4,6-7,9-10,12,18H,5,8,11,14-15H2,1-3H3 |
| InChIKey | INNVOJZHVMXRAT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |