About N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide
N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide (PubChem CID 172903993) has the molecular formula C16H25F2N5O2
and a molecular weight of 357.41 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide |
| PubChem CID | 172903993 |
| Molecular Formula | C16H25F2N5O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCN(c2cnn(CC(F)F)c(=O)c2)CC1 |
| InChI | InChI=1S/C16H25F2N5O2/c1-16(2,3)20-14(24)11-21-4-6-22(7-5-21)12-8-15(25)23(19-9-12)10-13(17)18/h8-9,13H,4-7,10-11H2,1-3H3,(H,20,24) |
| InChIKey | YCRJWUJFUAUWEV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide?
The IUPAC name of N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide (CID 172903993) is N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide.
What is the SMILES notation for N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide?
The canonical SMILES for N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide is CC(C)(C)NC(=O)CN1CCN(c2cnn(CC(F)F)c(=O)c2)CC1.
What is the InChIKey of N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide?
The InChIKey is YCRJWUJFUAUWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F2N5O2/c1-16(2,3)20-14(24)11-21-4-6-22(7-5-21)12-8-15(25)23(19-9-12)10-13(17)18/h8-9,13H,4-7,10-11H2,1-3H3,(H,20,24).
What are the key properties of N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide?
N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide has a molecular weight of 357.41 g/mol, XLogP of 0.55, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[4-[1-(2,2-difluoroethyl)-6-oxopyridazin-4-yl]piperazin-1-yl]acetamide is sourced from PubChem (CID 172903993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).