C20H25N5O2 — CID 172904637
2-cyclopropyl-N-methyl-N-[1-[(2-nitrophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine (PubChem CID 172904637) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-cyclopropyl-N-methyl-N-[1-[(2-nitrophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-methyl-N-[1-[(2-nitrophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172904637 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-cyclopropyl-N-methyl-N-[1-[(2-nitrophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine |
| SMILES | CN(c1ccnc(C2CC2)n1)C1CCCN(Cc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H25N5O2/c1-23(19-10-11-21-20(22-19)15-8-9-15)17-6-4-12-24(14-17)13-16-5-2-3-7-18(16)25(26)27/h2-3,5,7,10-11,15,17H,4,6,8-9,12-14H2,1H3 |
| InChIKey | XKIYLCYEEJFMEB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|