C23H29N3O — CID 172904902
2-(2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(2,3-dimethylphenyl)acetamide (PubChem CID 172904902) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-(2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-(2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 172904902 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-(2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CC3CN(Cc4ccccc4)CC3C2)c1C |
| InChI | InChI=1S/C23H29N3O/c1-17-7-6-10-22(18(17)2)24-23(27)16-26-14-20-12-25(13-21(20)15-26)11-19-8-4-3-5-9-19/h3-10,20-21H,11-16H2,1-2H3,(H,24,27) |
| InChIKey | QGEUFQKNLHZFTG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |