C16H20FN5O — CID 172904930
2-cyclopropyl-5-[[4-(6-fluoro-2-pyridinyl)-3-methylpiperazin-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 172904930) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-cyclopropyl-5-[[4-(6-fluoro-2-pyridinyl)-3-methylpiperazin-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-cyclopropyl-5-[[4-(6-fluoro-2-pyridinyl)-3-methylpiperazin-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 172904930 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-cyclopropyl-5-[[4-(6-fluoro-2-pyridinyl)-3-methylpiperazin-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | CC1CN(Cc2nnc(C3CC3)o2)CCN1c1cccc(F)n1 |
| InChI | InChI=1S/C16H20FN5O/c1-11-9-21(10-15-19-20-16(23-15)12-5-6-12)7-8-22(11)14-4-2-3-13(17)18-14/h2-4,11-12H,5-10H2,1H3 |
| InChIKey | WMZBTGMGTOAOEI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|