C13H17N5O — CID 172905193
3-azido-N-(3,5-dimethylphenyl)pyrrolidine-1-carboxamide (PubChem CID 172905193) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-azido-N-(3,5-dimethylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | 3-azido-N-(3,5-dimethylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 172905193 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-azido-N-(3,5-dimethylphenyl)pyrrolidine-1-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)N2CCC(N=[N+]=[N-])C2)c1 |
| InChI | InChI=1S/C13H17N5O/c1-9-5-10(2)7-12(6-9)15-13(19)18-4-3-11(8-18)16-17-14/h5-7,11H,3-4,8H2,1-2H3,(H,15,19) |
| InChIKey | MALQASAYOSDRSG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|