C17H17N7O2 — CID 172905849
6-[6-[(3-nitrophenyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 172905849) has the molecular formula C17H17N7O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 6-[6-[(3-nitrophenyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[6-[(3-nitrophenyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 172905849 |
| Molecular Formula | C17H17N7O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 6-[6-[(3-nitrophenyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | O=[N+]([O-])c1cccc(CN2C3CC2CN(c2ccc4nncn4n2)C3)c1 |
| InChI | InChI=1S/C17H17N7O2/c25-24(26)13-3-1-2-12(6-13)8-22-14-7-15(22)10-21(9-14)17-5-4-16-19-18-11-23(16)20-17/h1-6,11,14-15H,7-10H2 |
| InChIKey | ICPUOZOJWGIBJQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|