C12H11FN2O3 — CID 172906025
1-(3-fluoro-4-methoxyphenyl)-4-methylpyrazine-2,3-dione (PubChem CID 172906025) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-4-methylpyrazine-2,3-dione.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 172906025 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-4-methylpyrazine-2,3-dione |
| SMILES | COc1ccc(-n2ccn(C)c(=O)c2=O)cc1F |
| InChI | InChI=1S/C12H11FN2O3/c1-14-5-6-15(12(17)11(14)16)8-3-4-10(18-2)9(13)7-8/h3-7H,1-2H3 |
| InChIKey | GUOLEMXFBAFDJQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|