C17H15F3N2O2 — CID 172906880
4-[5-ethynyl-2-(trifluoromethoxy)phenyl]-1-(oxan-2-yl)pyrazole (PubChem CID 172906880) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is 4-[5-ethynyl-2-(trifluoromethoxy)phenyl]-1-(oxan-2-yl)pyrazole.
| Compound Name | 4-[5-ethynyl-2-(trifluoromethoxy)phenyl]-1-(oxan-2-yl)pyrazole |
|---|---|
| PubChem CID | 172906880 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-[5-ethynyl-2-(trifluoromethoxy)phenyl]-1-(oxan-2-yl)pyrazole |
| SMILES | C#Cc1ccc(OC(F)(F)F)c(-c2cnn(C3CCCCO3)c2)c1 |
| InChI | InChI=1S/C17H15F3N2O2/c1-2-12-6-7-15(24-17(18,19)20)14(9-12)13-10-21-22(11-13)16-5-3-4-8-23-16/h1,6-7,9-11,16H,3-5,8H2 |
| InChIKey | VGHBQEOBXMQUJX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|