C13H16BrNO4 — CID 172906977
2-(2-bromo-5-methoxyphenoxy)-N-(oxolan-3-yl)acetamide (PubChem CID 172906977) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenoxy)-N-(oxolan-3-yl)acetamide.
| Compound Name | 2-(2-bromo-5-methoxyphenoxy)-N-(oxolan-3-yl)acetamide |
|---|---|
| PubChem CID | 172906977 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-(2-bromo-5-methoxyphenoxy)-N-(oxolan-3-yl)acetamide |
| SMILES | COc1ccc(Br)c(OCC(=O)NC2CCOC2)c1 |
| InChI | InChI=1S/C13H16BrNO4/c1-17-10-2-3-11(14)12(6-10)19-8-13(16)15-9-4-5-18-7-9/h2-3,6,9H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | CGQYGQCKPYKBGX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |