C14H13F3N2O — CID 172907045
2-(1-cyclobutylpyrazol-4-yl)-5-(trifluoromethyl)phenol (PubChem CID 172907045) has the molecular formula C14H13F3N2O and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-(1-cyclobutylpyrazol-4-yl)-5-(trifluoromethyl)phenol.
| Compound Name | 2-(1-cyclobutylpyrazol-4-yl)-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 172907045 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(1-cyclobutylpyrazol-4-yl)-5-(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)ccc1-c1cnn(C2CCC2)c1 |
| InChI | InChI=1S/C14H13F3N2O/c15-14(16,17)10-4-5-12(13(20)6-10)9-7-18-19(8-9)11-2-1-3-11/h4-8,11,20H,1-3H2 |
| InChIKey | QFJYNAAHFRFALD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |