C31H33N3O3 — CID 172907452
8-hydroxy-2-(octylamino)-3,5-diphenyl-5H-chromeno[2,3-d]pyrimidin-4-one (PubChem CID 172907452) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 8-hydroxy-2-(octylamino)-3,5-diphenyl-5H-chromeno[2,3-d]pyrimidin-4-one.
| Compound Name | 8-hydroxy-2-(octylamino)-3,5-diphenyl-5H-chromeno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 172907452 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 8-hydroxy-2-(octylamino)-3,5-diphenyl-5H-chromeno[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCNc1nc2c(c(=O)n1-c1ccccc1)C(c1ccccc1)c1ccc(O)cc1O2 |
| InChI | InChI=1S/C31H33N3O3/c1-2-3-4-5-6-13-20-32-31-33-29-28(30(36)34(31)23-16-11-8-12-17-23)27(22-14-9-7-10-15-22)25-19-18-24(35)21-26(25)37-29/h7-12,14-19,21,27,35H,2-6,13,20H2,1H3,(H,32,33) |
| InChIKey | RNUOUAYYFRXCHR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|