About 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine
3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine (PubChem CID 172907557) has the molecular formula C6H2BrFIN3
and a molecular weight of 341.91 g/mol. Its IUPAC name is 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 172907557 |
| Molecular Formula | C6H2BrFIN3 |
| Molecular Weight | 341.91 g/mol |
| Exact Mass | 340.85 |
| IUPAC Name | 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine |
| SMILES | Fc1cc(I)c2c(Br)[nH]nc2n1 |
| InChI | InChI=1S/C6H2BrFIN3/c7-5-4-2(9)1-3(8)10-6(4)12-11-5/h1H,(H,10,11,12) |
| InChIKey | KULZKZIJBIJJKI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.91 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine (CID 172907557) is 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine is Fc1cc(I)c2c(Br)[nH]nc2n1.
What is the InChIKey of 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine?
The InChIKey is KULZKZIJBIJJKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrFIN3/c7-5-4-2(9)1-3(8)10-6(4)12-11-5/h1H,(H,10,11,12).
What are the key properties of 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine?
3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine has a molecular weight of 341.91 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-fluoro-4-iodo-2H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 172907557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).