C5H11Cl2N3O2 — CID 172907589
(3aS,6R,6aR)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazole-2,6-diamine;dihydrochloride (PubChem CID 172907589) has the molecular formula C5H11Cl2N3O2 and a molecular weight of 216.07 g/mol. Its IUPAC name is (3aS,6R,6aR)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazole-2,6-diamine;dihydrochloride.
| Compound Name | (3aS,6R,6aR)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazole-2,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 172907589 |
| Molecular Formula | C5H11Cl2N3O2 |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | (3aS,6R,6aR)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazole-2,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1=N[C@H]2OC[C@@H](N)[C@H]2O1 |
| InChI | InChI=1S/C5H9N3O2.2ClH/c6-2-1-9-4-3(2)10-5(7)8-4;;/h2-4H,1,6H2,(H2,7,8);2*1H/t2-,3-,4+;;/m1../s1 |
| InChIKey | DXAMZXMQOUFPSX-FLAXPJCKSA-N |
| XLogP | -0.77 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |