C40H50F3N3O2 — CID 172907996
(4R)-4-(3,5-ditert-butylphenyl)-2-[6-[(4R)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole (PubChem CID 172907996) has the molecular formula C40H50F3N3O2 and a molecular weight of 661.85 g/mol. Its IUPAC name is (4R)-4-(3,5-ditert-butylphenyl)-2-[6-[(4R)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-(3,5-ditert-butylphenyl)-2-[6-[(4R)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 172907996 |
| Molecular Formula | C40H50F3N3O2 |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.39 |
| IUPAC Name | (4R)-4-(3,5-ditert-butylphenyl)-2-[6-[(4R)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)c1cc([C@@H]2COC(c3cc(C(F)(F)F)cc(C4=N[C@H](c5cc(C(C)(C)C)cc(C(C)(C)C)c5)CO4)n3)=N2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H50F3N3O2/c1-36(2,3)25-13-23(14-26(17-25)37(4,5)6)32-21-47-34(45-32)30-19-29(40(41,42)43)20-31(44-30)35-46-33(22-48-35)24-15-27(38(7,8)9)18-28(16-24)39(10,11)12/h13-20,32-33H,21-22H2,1-12H3/t32-,33-/m0/s1 |
| InChIKey | ZIPBJPDODGLQFU-LQJZCPKCSA-N |
| XLogP | 10.33 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |