C9H15NO2 — CID 172908007
(8R,9aS)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 172908007) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (8R,9aS)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (8R,9aS)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 172908007 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (8R,9aS)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | O=C1CCC[C@H]2C[C@H](O)CCN12 |
| InChI | InChI=1S/C9H15NO2/c11-8-4-5-10-7(6-8)2-1-3-9(10)12/h7-8,11H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | LZCDZUXMTXYMQQ-JGVFFNPUSA-N |
| XLogP | 0.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |