C16H21N3O3S — CID 172908620
(3R,5S)-1-[2-(2-methylsulfanylphenyl)acetyl]piperidine-3,5-dicarboxamide (PubChem CID 172908620) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is (3R,5S)-1-[2-(2-methylsulfanylphenyl)acetyl]piperidine-3,5-dicarboxamide.
| Compound Name | (3R,5S)-1-[2-(2-methylsulfanylphenyl)acetyl]piperidine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 172908620 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3R,5S)-1-[2-(2-methylsulfanylphenyl)acetyl]piperidine-3,5-dicarboxamide |
| SMILES | CSc1ccccc1CC(=O)N1C[C@H](C(N)=O)C[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C16H21N3O3S/c1-23-13-5-3-2-4-10(13)7-14(20)19-8-11(15(17)21)6-12(9-19)16(18)22/h2-5,11-12H,6-9H2,1H3,(H2,17,21)(H2,18,22)/t11-,12+ |
| InChIKey | QGOOPSUEGGPXHT-TXEJJXNPSA-N |
| XLogP | 0.39 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |