C41H74O2 — CID 172908685
(10E,19E,23S,26Z)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-10,19,26,30-tetraen-3-one (PubChem CID 172908685) has the molecular formula C41H74O2 and a molecular weight of 599.04 g/mol. Its IUPAC name is (10E,19E,23S,26Z)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-10,19,26,30-tetraen-3-one.
| Compound Name | (10E,19E,23S,26Z)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-10,19,26,30-tetraen-3-one |
|---|---|
| PubChem CID | 172908685 |
| Molecular Formula | C41H74O2 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.57 |
| IUPAC Name | (10E,19E,23S,26Z)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-10,19,26,30-tetraen-3-one |
| SMILES | COC(C)(C)C(=O)CCC(C)CCC/C(C)=C/CCC(C)CCCC/C(C)=C/CC[C@H](C)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C41H74O2/c1-33(2)19-14-22-36(5)25-17-28-37(6)26-15-23-34(3)20-12-13-21-35(4)24-16-27-38(7)29-18-30-39(8)31-32-40(42)41(9,10)43-11/h19,23,25,27,35,37,39H,12-18,20-22,24,26,28-32H2,1-11H3/b34-23+,36-25-,38-27+/t35?,37-,39?/m0/s1 |
| InChIKey | WQFQFDRLTDSPCN-AXANFGSESA-N |
| XLogP | 13.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|