About 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]
2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] (PubChem CID 172908778) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine].
Molecular Properties
| Compound Name | 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] |
| PubChem CID | 172908778 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] |
| SMILES | Cc1ncc2c(n1)COC21CNC1 |
| InChI | InChI=1S/C9H11N3O/c1-6-11-2-7-8(12-6)3-13-9(7)4-10-5-9/h2,10H,3-5H2,1H3 |
| InChIKey | NSOSZSPEQUBSOQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
The IUPAC name of 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] (CID 172908778) is 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine].
What is the SMILES notation for 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
The canonical SMILES for 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] is Cc1ncc2c(n1)COC21CNC1.
What is the InChIKey of 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
The InChIKey is NSOSZSPEQUBSOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-6-11-2-7-8(12-6)3-13-9(7)4-10-5-9/h2,10H,3-5H2,1H3.
What are the key properties of 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] has a molecular weight of 177.21 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] is sourced from PubChem (CID 172908778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).