C12H19N3O3 — CID 172909205
2-methyl-13-oxa-2,4,10-triazadispiro[4.1.57.35]pentadecane-1,3-dione (PubChem CID 172909205) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-methyl-13-oxa-2,4,10-triazadispiro[4.1.57.35]pentadecane-1,3-dione.
| Compound Name | 2-methyl-13-oxa-2,4,10-triazadispiro[4.1.57.35]pentadecane-1,3-dione |
|---|---|
| PubChem CID | 172909205 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-methyl-13-oxa-2,4,10-triazadispiro[4.1.57.35]pentadecane-1,3-dione |
| SMILES | CN1C(=O)NC2(CCOC3(CCNCC3)C2)C1=O |
| InChI | InChI=1S/C12H19N3O3/c1-15-9(16)12(14-10(15)17)4-7-18-11(8-12)2-5-13-6-3-11/h13H,2-8H2,1H3,(H,14,17) |
| InChIKey | OTXCPHBWHFLSKK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|