C12H21N3 — CID 172909232
4-[2-(2,5-dimethylimidazol-1-yl)ethyl]piperidine (PubChem CID 172909232) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylimidazol-1-yl)ethyl]piperidine.
| Compound Name | 4-[2-(2,5-dimethylimidazol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 172909232 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 4-[2-(2,5-dimethylimidazol-1-yl)ethyl]piperidine |
| SMILES | Cc1cnc(C)n1CCC1CCNCC1 |
| InChI | InChI=1S/C12H21N3/c1-10-9-14-11(2)15(10)8-5-12-3-6-13-7-4-12/h9,12-13H,3-8H2,1-2H3 |
| InChIKey | MZQTZLQGXIRTTL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |