About 5-ethynyl-6-phenyl-1,3-benzodioxole
5-ethynyl-6-phenyl-1,3-benzodioxole (PubChem CID 172909317) has the molecular formula C15H10O2
and a molecular weight of 222.24 g/mol. Its IUPAC name is 5-ethynyl-6-phenyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-ethynyl-6-phenyl-1,3-benzodioxole |
| PubChem CID | 172909317 |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 5-ethynyl-6-phenyl-1,3-benzodioxole |
| SMILES | C#Cc1cc2c(cc1-c1ccccc1)OCO2 |
| InChI | InChI=1S/C15H10O2/c1-2-11-8-14-15(17-10-16-14)9-13(11)12-6-4-3-5-7-12/h1,3-9H,10H2 |
| InChIKey | SHGFQHTWBFNNAZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-6-phenyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-6-phenyl-1,3-benzodioxole?
The IUPAC name of 5-ethynyl-6-phenyl-1,3-benzodioxole (CID 172909317) is 5-ethynyl-6-phenyl-1,3-benzodioxole.
What is the SMILES notation for 5-ethynyl-6-phenyl-1,3-benzodioxole?
The canonical SMILES for 5-ethynyl-6-phenyl-1,3-benzodioxole is C#Cc1cc2c(cc1-c1ccccc1)OCO2.
What is the InChIKey of 5-ethynyl-6-phenyl-1,3-benzodioxole?
The InChIKey is SHGFQHTWBFNNAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O2/c1-2-11-8-14-15(17-10-16-14)9-13(11)12-6-4-3-5-7-12/h1,3-9H,10H2.
What are the key properties of 5-ethynyl-6-phenyl-1,3-benzodioxole?
5-ethynyl-6-phenyl-1,3-benzodioxole has a molecular weight of 222.24 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-6-phenyl-1,3-benzodioxole is sourced from PubChem (CID 172909317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).