About cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride
cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride (PubChem CID 172909610) has the molecular formula C8H17ClN2OS
and a molecular weight of 224.76 g/mol. Its IUPAC name is cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride.
Molecular Properties
| Compound Name | cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride |
| PubChem CID | 172909610 |
| Molecular Formula | C8H17ClN2OS |
| Molecular Weight | 224.76 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride |
| SMILES | Cl.[H]N=S(=O)(C1CC1)N1CCCCC1 |
| InChI | InChI=1S/C8H16N2OS.ClH/c9-12(11,8-4-5-8)10-6-2-1-3-7-10;/h8-9H,1-7H2;1H |
| InChIKey | VHUZQHIGXSZFTO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride?
The IUPAC name of cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride (CID 172909610) is cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride.
What is the SMILES notation for cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride?
The canonical SMILES for cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride is Cl.[H]N=S(=O)(C1CC1)N1CCCCC1.
What is the InChIKey of cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride?
The InChIKey is VHUZQHIGXSZFTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2OS.ClH/c9-12(11,8-4-5-8)10-6-2-1-3-7-10;/h8-9H,1-7H2;1H.
What are the key properties of cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride?
cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride has a molecular weight of 224.76 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-imino-oxo-piperidin-1-yl-λ6-sulfane;hydrochloride is sourced from PubChem (CID 172909610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).