About (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid
(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid (PubChem CID 172909659) has the molecular formula C21H13NO6S
and a molecular weight of 407.40 g/mol. Its IUPAC name is (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid.
Molecular Properties
| Compound Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid |
| PubChem CID | 172909659 |
| Molecular Formula | C21H13NO6S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid |
| SMILES | O=C(S)NOc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H13NO6S/c23-11-5-7-15-17(9-11)26-18-10-12(28-22-20(25)29)6-8-16(18)21(15)14-4-2-1-3-13(14)19(24)27-21/h1-10,23H,(H2,22,25,29) |
| InChIKey | PUQQBNGWUKSTLB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid?
The IUPAC name of (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid (CID 172909659) is (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid.
What is the SMILES notation for (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid?
The canonical SMILES for (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid is O=C(S)NOc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21.
What is the InChIKey of (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid?
The InChIKey is PUQQBNGWUKSTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13NO6S/c23-11-5-7-15-17(9-11)26-18-10-12(28-22-20(25)29)6-8-16(18)21(15)14-4-2-1-3-13(14)19(24)27-21/h1-10,23H,(H2,22,25,29).
What are the key properties of (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid?
(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid has a molecular weight of 407.40 g/mol, XLogP of 3.89, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid is sourced from PubChem (CID 172909659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).