C19H26Cl2N4O3S — CID 172910930
(1R,9S)-N-(2-methoxyethyl)-6-oxo-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide;dihydrochloride (PubChem CID 172910930) has the molecular formula C19H26Cl2N4O3S and a molecular weight of 461.42 g/mol. Its IUPAC name is (1R,9S)-N-(2-methoxyethyl)-6-oxo-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide;dihydrochloride.
| Compound Name | (1R,9S)-N-(2-methoxyethyl)-6-oxo-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 172910930 |
| Molecular Formula | C19H26Cl2N4O3S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (1R,9S)-N-(2-methoxyethyl)-6-oxo-N-(1,3-thiazol-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-5-carboxamide;dihydrochloride |
| SMILES | COCCN(Cc1nccs1)C(=O)c1ccc2n(c1=O)C[C@@H]1CNC[C@H]2C1.Cl.Cl |
| InChI | InChI=1S/C19H24N4O3S.2ClH/c1-26-6-5-22(12-17-21-4-7-27-17)18(24)15-2-3-16-14-8-13(9-20-10-14)11-23(16)19(15)25;;/h2-4,7,13-14,20H,5-6,8-12H2,1H3;2*1H/t13-,14+;;/m0../s1 |
| InChIKey | NMSFXVBQRSUUBP-WICJZZOFSA-N |
| XLogP | 2.14 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |