C19H28F3N5O4 — CID 172910936
[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]methanone;formic acid (PubChem CID 172910936) has the molecular formula C19H28F3N5O4 and a molecular weight of 447.46 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]methanone;formic acid.
| Compound Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]methanone;formic acid |
|---|---|
| PubChem CID | 172910936 |
| Molecular Formula | C19H28F3N5O4 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]methanone;formic acid |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3n[nH]c(C(F)(F)F)n3)C[C@@H]2C[C@H]1OCC1CC1.O=CO |
| InChI | InChI=1S/C18H26F3N5O2.CH2O2/c1-25(2)13-5-11-7-26(8-12(11)6-14(13)28-9-10-3-4-10)16(27)15-22-17(24-23-15)18(19,20)21;2-1-3/h10-14H,3-9H2,1-2H3,(H,22,23,24);1H,(H,2,3)/t11-,12+,13-,14-;/m1./s1 |
| InChIKey | AVKPMHMOIYXPRI-TWPGKBSFSA-N |
| XLogP | 1.73 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|