C24H27NO6S — CID 172911293
formic acid;4-[2-[6-(3-methylsulfonylphenyl)naphthalen-2-yl]oxyethyl]morpholine (PubChem CID 172911293) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is formic acid;4-[2-[6-(3-methylsulfonylphenyl)naphthalen-2-yl]oxyethyl]morpholine.
| Compound Name | formic acid;4-[2-[6-(3-methylsulfonylphenyl)naphthalen-2-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 172911293 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | formic acid;4-[2-[6-(3-methylsulfonylphenyl)naphthalen-2-yl]oxyethyl]morpholine |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc3cc(OCCN4CCOCC4)ccc3c2)c1.O=CO |
| InChI | InChI=1S/C23H25NO4S.CH2O2/c1-29(25,26)23-4-2-3-18(17-23)19-5-6-21-16-22(8-7-20(21)15-19)28-14-11-24-9-12-27-13-10-24;2-1-3/h2-8,15-17H,9-14H2,1H3;1H,(H,2,3) |
| InChIKey | FNEYWEXKTXWQTM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|