C16H26ClNO — CID 17291144
N-[(4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride (PubChem CID 17291144) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is N-[(4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[(4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291144 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[(4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride |
| SMILES | C=CCOc1ccc(CNCCCCCC)cc1.Cl |
| InChI | InChI=1S/C16H25NO.ClH/c1-3-5-6-7-12-17-14-15-8-10-16(11-9-15)18-13-4-2;/h4,8-11,17H,2-3,5-7,12-14H2,1H3;1H |
| InChIKey | VAIBPWQASOKSRD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|