About formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate
formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate (PubChem CID 172911669) has the molecular formula C17H28N4O5
and a molecular weight of 368.43 g/mol. Its IUPAC name is formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate.
Molecular Properties
| Compound Name | formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate |
| PubChem CID | 172911669 |
| Molecular Formula | C17H28N4O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate |
| SMILES | CCn1cncc1CN1C[C@H](NC(C)=O)CC[C@H](C(=O)OC)C1.O=CO |
| InChI | InChI=1S/C16H26N4O3.CH2O2/c1-4-20-11-17-7-15(20)10-19-8-13(16(22)23-3)5-6-14(9-19)18-12(2)21;2-1-3/h7,11,13-14H,4-6,8-10H2,1-3H3,(H,18,21);1H,(H,2,3)/t13-,14+;/m0./s1 |
| InChIKey | WUEZBXATAVQMGT-LMRHVHIWSA-N |
| XLogP | 0.49 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate?
The IUPAC name of formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate (CID 172911669) is formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate.
What is the SMILES notation for formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate?
The canonical SMILES for formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate is CCn1cncc1CN1C[C@H](NC(C)=O)CC[C@H](C(=O)OC)C1.O=CO.
What is the InChIKey of formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate?
The InChIKey is WUEZBXATAVQMGT-LMRHVHIWSA-N. The full InChI is InChI=1S/C16H26N4O3.CH2O2/c1-4-20-11-17-7-15(20)10-19-8-13(16(22)23-3)5-6-14(9-19)18-12(2)21;2-1-3/h7,11,13-14H,4-6,8-10H2,1-3H3,(H,18,21);1H,(H,2,3)/t13-,14+;/m0./s1.
What are the key properties of formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate?
formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate has a molecular weight of 368.43 g/mol, XLogP of 0.49, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;methyl (3S,6R)-6-acetamido-1-[(3-ethylimidazol-4-yl)methyl]azepane-3-carboxylate is sourced from PubChem (CID 172911669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).