C21H30ClN3O4 — CID 172912215
[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-chloro-2-pyridinyl)methanone;formic acid (PubChem CID 172912215) has the molecular formula C21H30ClN3O4 and a molecular weight of 423.94 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-chloro-2-pyridinyl)methanone;formic acid.
| Compound Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-chloro-2-pyridinyl)methanone;formic acid |
|---|---|
| PubChem CID | 172912215 |
| Molecular Formula | C21H30ClN3O4 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-chloro-2-pyridinyl)methanone;formic acid |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3ccc(Cl)cn3)C[C@@H]2C[C@H]1OCC1CC1.O=CO |
| InChI | InChI=1S/C20H28ClN3O2.CH2O2/c1-23(2)18-7-14-10-24(20(25)17-6-5-16(21)9-22-17)11-15(14)8-19(18)26-12-13-3-4-13;2-1-3/h5-6,9,13-15,18-19H,3-4,7-8,10-12H2,1-2H3;1H,(H,2,3)/t14-,15+,18-,19-;/m1./s1 |
| InChIKey | TUAWRLHLGSGTPL-BRIXBYFRSA-N |
| XLogP | 2.64 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|