C20H30ClN3O2 — CID 172912361
3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methyl-1-(piperidin-3-ylmethyl)pyridin-2-one;hydrochloride (PubChem CID 172912361) has the molecular formula C20H30ClN3O2 and a molecular weight of 379.93 g/mol. Its IUPAC name is 3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methyl-1-(piperidin-3-ylmethyl)pyridin-2-one;hydrochloride.
| Compound Name | 3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methyl-1-(piperidin-3-ylmethyl)pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 172912361 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methyl-1-(piperidin-3-ylmethyl)pyridin-2-one;hydrochloride |
| SMILES | Cc1ccn(CC2CCCNC2)c(=O)c1C(=O)N1C[C@H]2CCC[C@H]2C1.Cl |
| InChI | InChI=1S/C20H29N3O2.ClH/c1-14-7-9-22(11-15-4-3-8-21-10-15)19(24)18(14)20(25)23-12-16-5-2-6-17(16)13-23;/h7,9,15-17,21H,2-6,8,10-13H2,1H3;1H/t15?,16-,17+; |
| InChIKey | QSVUVCRUHJAKJB-ZXVFAPHLSA-N |
| XLogP | 2.45 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |