C26H41Cl2N3O2 — CID 172912749
[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone;dihydrochloride (PubChem CID 172912749) has the molecular formula C26H41Cl2N3O2 and a molecular weight of 498.54 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone;dihydrochloride.
| Compound Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 172912749 |
| Molecular Formula | C26H41Cl2N3O2 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone;dihydrochloride |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3ccc(C4CCNCC4)cc3)C[C@@H]2C[C@H]1OCC1CC1.Cl.Cl |
| InChI | InChI=1S/C26H39N3O2.2ClH/c1-28(2)24-13-22-15-29(16-23(22)14-25(24)31-17-18-3-4-18)26(30)21-7-5-19(6-8-21)20-9-11-27-12-10-20;;/h5-8,18,20,22-25,27H,3-4,9-17H2,1-2H3;2*1H/t22-,23+,24-,25-;;/m1../s1 |
| InChIKey | LAVLACLQZAIDAI-VQLOCCQHSA-N |
| XLogP | 4.20 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |