C13H22ClNO — CID 17291298
N-[(4-ethoxyphenyl)methyl]-2-methylpropan-1-amine;hydrochloride (PubChem CID 17291298) has the molecular formula C13H22ClNO and a molecular weight of 243.78 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-2-methylpropan-1-amine;hydrochloride.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-2-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291298 |
| Molecular Formula | C13H22ClNO |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-2-methylpropan-1-amine;hydrochloride |
| SMILES | CCOc1ccc(CNCC(C)C)cc1.Cl |
| InChI | InChI=1S/C13H21NO.ClH/c1-4-15-13-7-5-12(6-8-13)10-14-9-11(2)3;/h5-8,11,14H,4,9-10H2,1-3H3;1H |
| InChIKey | DBRLRBIBSFDBOH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |