C18H25ClN4O3 — CID 172913135
N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide;hydrochloride (PubChem CID 172913135) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide;hydrochloride.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172913135 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide;hydrochloride |
| SMILES | CO[C@H]1C[C@@H]2CNC[C@@H]2C[C@@H]1NC(=O)c1ccc(Cn2cccn2)o1.Cl |
| InChI | InChI=1S/C18H24N4O3.ClH/c1-24-17-8-13-10-19-9-12(13)7-15(17)21-18(23)16-4-3-14(25-16)11-22-6-2-5-20-22;/h2-6,12-13,15,17,19H,7-11H2,1H3,(H,21,23);1H/t12-,13+,15-,17-;/m0./s1 |
| InChIKey | IHHOCBCWMAIOEE-YYMCOREQSA-N |
| XLogP | 1.69 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |