C23H34N2O4 — CID 172913158
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one;formic acid (PubChem CID 172913158) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one;formic acid.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one;formic acid |
|---|---|
| PubChem CID | 172913158 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one;formic acid |
| SMILES | CC(C)(C(=O)N1C[C@H]2C[C@@H](N3CCCC3)[C@H](O)C[C@H]2C1)c1ccccc1.O=CO |
| InChI | InChI=1S/C22H32N2O2.CH2O2/c1-22(2,18-8-4-3-5-9-18)21(26)24-14-16-12-19(23-10-6-7-11-23)20(25)13-17(16)15-24;2-1-3/h3-5,8-9,16-17,19-20,25H,6-7,10-15H2,1-2H3;1H,(H,2,3)/t16-,17+,19-,20-;/m1./s1 |
| InChIKey | WUZKORMCWALWPR-FSGHUTCMSA-N |
| XLogP | 2.36 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|