About 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol
2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol (PubChem CID 172913756) has the molecular formula C14H13N3O3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol |
| PubChem CID | 172913756 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol |
| SMILES | Oc1nc(NCc2ccco2)sc1/C=N/Cc1ccco1 |
| InChI | InChI=1S/C14H13N3O3S/c18-13-12(9-15-7-10-3-1-5-19-10)21-14(17-13)16-8-11-4-2-6-20-11/h1-6,9,18H,7-8H2,(H,16,17)/b15-9+ |
| InChIKey | LXYWOUVIFAHEGV-OQLLNIDSSA-N |
| XLogP | 3.27 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol?
The IUPAC name of 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol (CID 172913756) is 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol.
What is the SMILES notation for 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol?
The canonical SMILES for 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol is Oc1nc(NCc2ccco2)sc1/C=N/Cc1ccco1.
What is the InChIKey of 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol?
The InChIKey is LXYWOUVIFAHEGV-OQLLNIDSSA-N. The full InChI is InChI=1S/C14H13N3O3S/c18-13-12(9-15-7-10-3-1-5-19-10)21-14(17-13)16-8-11-4-2-6-20-11/h1-6,9,18H,7-8H2,(H,16,17)/b15-9+.
What are the key properties of 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol?
2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol has a molecular weight of 303.34 g/mol, XLogP of 3.27, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-ylmethylamino)-5-(furan-2-ylmethyliminomethyl)-1,3-thiazol-4-ol is sourced from PubChem (CID 172913756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).